C10H7F2N3 — CID 144724919
4,7-difluoro-2,2-dimethylbenzimidazole-5-carbonitrile (PubChem CID 144724919) has the molecular formula C10H7F2N3 and a molecular weight of 207.18 g/mol. Its IUPAC name is 4,7-difluoro-2,2-dimethylbenzimidazole-5-carbonitrile.
| Compound Name | 4,7-difluoro-2,2-dimethylbenzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 144724919 |
| Molecular Formula | C10H7F2N3 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 4,7-difluoro-2,2-dimethylbenzimidazole-5-carbonitrile |
| SMILES | CC1(C)N=c2c(F)cc(C#N)c(F)c2=N1 |
| InChI | InChI=1S/C10H7F2N3/c1-10(2)14-8-6(11)3-5(4-13)7(12)9(8)15-10/h3H,1-2H3 |
| InChIKey | MCRFYOAVYIIILA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |