C11H11F3N2 — CID 178175300
4-(tert-butylamino)-2,3,5-trifluorobenzonitrile (PubChem CID 178175300) has the molecular formula C11H11F3N2 and a molecular weight of 228.22 g/mol. Its IUPAC name is 4-(tert-butylamino)-2,3,5-trifluorobenzonitrile.
| Compound Name | 4-(tert-butylamino)-2,3,5-trifluorobenzonitrile |
|---|---|
| PubChem CID | 178175300 |
| Molecular Formula | C11H11F3N2 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-(tert-butylamino)-2,3,5-trifluorobenzonitrile |
| SMILES | CC(C)(C)Nc1c(F)cc(C#N)c(F)c1F |
| InChI | InChI=1S/C11H11F3N2/c1-11(2,3)16-10-7(12)4-6(5-15)8(13)9(10)14/h4,16H,1-3H3 |
| InChIKey | JCZDGWBDBNNINA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|