C18H15Br — CID 144726276
5-bromo-4a,7,8,12c-tetrahydrobenzo[c]phenanthrene (PubChem CID 144726276) has the molecular formula C18H15Br and a molecular weight of 311.22 g/mol. Its IUPAC name is 5-bromo-4a,7,8,12c-tetrahydrobenzo[c]phenanthrene.
| Compound Name | 5-bromo-4a,7,8,12c-tetrahydrobenzo[c]phenanthrene |
|---|---|
| PubChem CID | 144726276 |
| Molecular Formula | C18H15Br |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 5-bromo-4a,7,8,12c-tetrahydrobenzo[c]phenanthrene |
| SMILES | BrC1=CC2=C(c3ccccc3CC2)C2C=CC=CC12 |
| InChI | InChI=1S/C18H15Br/c19-17-11-13-10-9-12-5-1-2-6-14(12)18(13)16-8-4-3-7-15(16)17/h1-8,11,15-16H,9-10H2 |
| InChIKey | TYZIKFSFRQGFJQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |