C23H42 — CID 144732645
7-[(Z)-but-2-en-2-yl]-8-ethyl-7-methyl-3,4-dipropyl-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene (PubChem CID 144732645) has the molecular formula C23H42 and a molecular weight of 318.59 g/mol. Its IUPAC name is 7-[(Z)-but-2-en-2-yl]-8-ethyl-7-methyl-3,4-dipropyl-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene.
| Compound Name | 7-[(Z)-but-2-en-2-yl]-8-ethyl-7-methyl-3,4-dipropyl-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene |
|---|---|
| PubChem CID | 144732645 |
| Molecular Formula | C23H42 |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 318.33 |
| IUPAC Name | 7-[(Z)-but-2-en-2-yl]-8-ethyl-7-methyl-3,4-dipropyl-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene |
| SMILES | C/C=C(/C)C1(C)CCC2C(CCC)C(CCC)CCC2C1CC |
| InChI | InChI=1S/C23H42/c1-7-11-18-13-14-21-20(19(18)12-8-2)15-16-23(6,17(5)9-3)22(21)10-4/h9,18-22H,7-8,10-16H2,1-6H3/b17-9- |
| InChIKey | DMZSFERSRGARBG-MFOYZWKCSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|