C10H9BrO — CID 144743113
6-bromo-2,5-dihydro-1-benzoxepine (PubChem CID 144743113) has the molecular formula C10H9BrO and a molecular weight of 225.09 g/mol. Its IUPAC name is 6-bromo-2,5-dihydro-1-benzoxepine.
| Compound Name | 6-bromo-2,5-dihydro-1-benzoxepine |
|---|---|
| PubChem CID | 144743113 |
| Molecular Formula | C10H9BrO |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | 6-bromo-2,5-dihydro-1-benzoxepine |
| SMILES | Brc1cccc2c1CC=CCO2 |
| InChI | InChI=1S/C10H9BrO/c11-9-5-3-6-10-8(9)4-1-2-7-12-10/h1-3,5-6H,4,7H2 |
| InChIKey | AGYVGTVTNRPRKF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|