C20H28O — CID 144776351
ethane;3-[(3Z,5E)-6,7,7-trimethylocta-1,3,5-trien-2-yl]benzaldehyde (PubChem CID 144776351) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is ethane;3-[(3Z,5E)-6,7,7-trimethylocta-1,3,5-trien-2-yl]benzaldehyde.
| Compound Name | ethane;3-[(3Z,5E)-6,7,7-trimethylocta-1,3,5-trien-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 144776351 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | ethane;3-[(3Z,5E)-6,7,7-trimethylocta-1,3,5-trien-2-yl]benzaldehyde |
| SMILES | C=C(/C=C\C=C(/C)C(C)(C)C)c1cccc(C=O)c1.CC |
| InChI | InChI=1S/C18H22O.C2H6/c1-14(8-6-9-15(2)18(3,4)5)17-11-7-10-16(12-17)13-19;1-2/h6-13H,1H2,2-5H3;1-2H3/b8-6-,15-9+; |
| InChIKey | JJXMXNJRGWKWJH-JBRUHATBSA-N |
| XLogP | 6.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|