C23H27Cl2N3 — CID 144782568
2-(3,4-dichlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine (PubChem CID 144782568) has the molecular formula C23H27Cl2N3 and a molecular weight of 416.40 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine.
| Compound Name | 2-(3,4-dichlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine |
|---|---|
| PubChem CID | 144782568 |
| Molecular Formula | C23H27Cl2N3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine |
| SMILES | CCCN(CCC)c1cccnc1-c1ccc(Cl)c(Cl)c1.Cc1ccncc1 |
| InChI | InChI=1S/C17H20Cl2N2.C6H7N/c1-3-10-21(11-4-2)16-6-5-9-20-17(16)13-7-8-14(18)15(19)12-13;1-6-2-4-7-5-3-6/h5-9,12H,3-4,10-11H2,1-2H3;2-5H,1H3 |
| InChIKey | XKRSQBOCOHJWCT-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |