C38H52N3O6+ — CID 144783344
[9-[2-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethylcarbamoyl]phenyl]-6-(methylaminooxy)xanthen-3-ylidene]-dimethylazanium;methanol (PubChem CID 144783344) has the molecular formula C38H52N3O6+ and a molecular weight of 646.85 g/mol. Its IUPAC name is [9-[2-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethylcarbamoyl]phenyl]-6-(methylaminooxy)xanthen-3-ylidene]-dimethylazanium;methanol.
| Compound Name | [9-[2-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethylcarbamoyl]phenyl]-6-(methylaminooxy)xanthen-3-ylidene]-dimethylazanium;methanol |
|---|---|
| PubChem CID | 144783344 |
| Molecular Formula | C38H52N3O6+ |
| Molecular Weight | 646.85 g/mol |
| Exact Mass | 646.39 |
| IUPAC Name | [9-[2-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethylcarbamoyl]phenyl]-6-(methylaminooxy)xanthen-3-ylidene]-dimethylazanium;methanol |
| SMILES | CNOc1ccc2c(-c3ccccc3C(=O)NCCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C)c3ccc(=[N+](C)C)cc-3oc2c1.CO |
| InChI | InChI=1S/C37H47N3O5.CH4O/c1-35(2,3)23-37(7,36(4,5)6)34(42)43-20-19-39-33(41)27-14-12-11-13-26(27)32-28-17-15-24(40(9)10)21-30(28)44-31-22-25(45-38-8)16-18-29(31)32;1-2/h11-18,21-22,38H,19-20,23H2,1-10H3;2H,1H3/p+1 |
| InChIKey | OQHLPQFNGRRGFL-UHFFFAOYSA-O |
| XLogP | 6.12 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.85 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|