C25H32N6 — CID 144797292
4-[(4E,6Z)-5-aminoocta-1,4,6-trien-2-yl]-5-ethenyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 144797292) has the molecular formula C25H32N6 and a molecular weight of 416.57 g/mol. Its IUPAC name is 4-[(4E,6Z)-5-aminoocta-1,4,6-trien-2-yl]-5-ethenyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[(4E,6Z)-5-aminoocta-1,4,6-trien-2-yl]-5-ethenyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 144797292 |
| Molecular Formula | C25H32N6 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 4-[(4E,6Z)-5-aminoocta-1,4,6-trien-2-yl]-5-ethenyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | C=Cc1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1C(=C)C/C=C(N)\C=C/C |
| InChI | InChI=1S/C25H32N6/c1-5-7-21(26)9-8-19(3)24-20(6-2)18-27-25(29-24)28-22-10-12-23(13-11-22)31-16-14-30(4)15-17-31/h5-7,9-13,18H,2-3,8,14-17,26H2,1,4H3,(H,27,28,29)/b7-5-,21-9+ |
| InChIKey | BGCJAVAWUONNKT-SIYHAENOSA-N |
| XLogP | 4.44 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|