C10H12N2 — CID 144953071
1-imino-N-methyl-2,3-dihydroinden-5-amine (PubChem CID 144953071) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-imino-N-methyl-2,3-dihydroinden-5-amine.
| Compound Name | 1-imino-N-methyl-2,3-dihydroinden-5-amine |
|---|---|
| PubChem CID | 144953071 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1-imino-N-methyl-2,3-dihydroinden-5-amine |
| SMILES | [H]/N=C1\CCc2cc(NC)ccc21 |
| InChI | InChI=1S/C10H12N2/c1-12-8-3-4-9-7(6-8)2-5-10(9)11/h3-4,6,11-12H,2,5H2,1H3/b11-10+ |
| InChIKey | PMROOBGQEKMRGR-ZHACJKMWSA-N |
| XLogP | 2.04 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|