C27H25N — CID 144968870
(Z)-2-[2,3-bis(ethenyl)naphthalen-1-yl]-N-[1-(4-methylphenyl)ethenyl]but-2-en-1-imine (PubChem CID 144968870) has the molecular formula C27H25N and a molecular weight of 363.50 g/mol. Its IUPAC name is (Z)-2-[2,3-bis(ethenyl)naphthalen-1-yl]-N-[1-(4-methylphenyl)ethenyl]but-2-en-1-imine.
| Compound Name | (Z)-2-[2,3-bis(ethenyl)naphthalen-1-yl]-N-[1-(4-methylphenyl)ethenyl]but-2-en-1-imine |
|---|---|
| PubChem CID | 144968870 |
| Molecular Formula | C27H25N |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | (Z)-2-[2,3-bis(ethenyl)naphthalen-1-yl]-N-[1-(4-methylphenyl)ethenyl]but-2-en-1-imine |
| SMILES | C=Cc1cc2ccccc2c(C(=C/C)/C=N/C(=C)c2ccc(C)cc2)c1C=C |
| InChI | InChI=1S/C27H25N/c1-6-21-17-24-11-9-10-12-26(24)27(25(21)8-3)22(7-2)18-28-20(5)23-15-13-19(4)14-16-23/h6-18H,1,3,5H2,2,4H3/b22-7+,28-18+ |
| InChIKey | KVTYFXGAVVMMBT-LFYAVIHQSA-N |
| XLogP | 7.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|