C17H20Cl2N4OS2 — CID 145044071
5,6-dichloro-N-[3-(diethylamino)propylsulfanyl]imidazo[2,1-b][1,3]benzothiazole-2-carboxamide (PubChem CID 145044071) has the molecular formula C17H20Cl2N4OS2 and a molecular weight of 431.41 g/mol. Its IUPAC name is 5,6-dichloro-N-[3-(diethylamino)propylsulfanyl]imidazo[2,1-b][1,3]benzothiazole-2-carboxamide.
| Compound Name | 5,6-dichloro-N-[3-(diethylamino)propylsulfanyl]imidazo[2,1-b][1,3]benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 145044071 |
| Molecular Formula | C17H20Cl2N4OS2 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 5,6-dichloro-N-[3-(diethylamino)propylsulfanyl]imidazo[2,1-b][1,3]benzothiazole-2-carboxamide |
| SMILES | CCN(CC)CCCSNC(=O)c1cn2c(n1)sc1c(Cl)c(Cl)ccc12 |
| InChI | InChI=1S/C17H20Cl2N4OS2/c1-3-22(4-2)8-5-9-25-21-16(24)12-10-23-13-7-6-11(18)14(19)15(13)26-17(23)20-12/h6-7,10H,3-5,8-9H2,1-2H3,(H,21,24) |
| InChIKey | GTGAQZFBUBNMKD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|