C22H28O4 — CID 145063823
(4-methylphenyl) 4-[hydroxy-(4-methylcyclohexa-2,4-dien-1-yl)oxymethyl]cyclohexane-1-carboxylate (PubChem CID 145063823) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (4-methylphenyl) 4-[hydroxy-(4-methylcyclohexa-2,4-dien-1-yl)oxymethyl]cyclohexane-1-carboxylate.
| Compound Name | (4-methylphenyl) 4-[hydroxy-(4-methylcyclohexa-2,4-dien-1-yl)oxymethyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 145063823 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (4-methylphenyl) 4-[hydroxy-(4-methylcyclohexa-2,4-dien-1-yl)oxymethyl]cyclohexane-1-carboxylate |
| SMILES | CC1=CCC(OC(O)C2CCC(C(=O)Oc3ccc(C)cc3)CC2)C=C1 |
| InChI | InChI=1S/C22H28O4/c1-15-3-11-19(12-4-15)25-21(23)17-7-9-18(10-8-17)22(24)26-20-13-5-16(2)6-14-20/h3-6,11-13,17-18,20,22,24H,7-10,14H2,1-2H3 |
| InChIKey | SYCLARANGXPZAB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|