C24H23FN4O3 — CID 145075080
(5Z,7Z)-N-(4-fluoro-2-methoxy-5-nitrophenyl)-3-methyl-6-(1-methylindol-3-yl)-3,4-dihydroazocin-2-amine (PubChem CID 145075080) has the molecular formula C24H23FN4O3 and a molecular weight of 434.47 g/mol. Its IUPAC name is (5Z,7Z)-N-(4-fluoro-2-methoxy-5-nitrophenyl)-3-methyl-6-(1-methylindol-3-yl)-3,4-dihydroazocin-2-amine.
| Compound Name | (5Z,7Z)-N-(4-fluoro-2-methoxy-5-nitrophenyl)-3-methyl-6-(1-methylindol-3-yl)-3,4-dihydroazocin-2-amine |
|---|---|
| PubChem CID | 145075080 |
| Molecular Formula | C24H23FN4O3 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (5Z,7Z)-N-(4-fluoro-2-methoxy-5-nitrophenyl)-3-methyl-6-(1-methylindol-3-yl)-3,4-dihydroazocin-2-amine |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1N/C1=N/C=C\C(c2cn(C)c3ccccc23)=C/CC1C |
| InChI | InChI=1S/C24H23FN4O3/c1-15-8-9-16(18-14-28(2)21-7-5-4-6-17(18)21)10-11-26-24(15)27-20-13-22(29(30)31)19(25)12-23(20)32-3/h4-7,9-15H,8H2,1-3H3,(H,26,27)/b11-10-,16-9+ |
| InChIKey | QODKGYBULAUHKX-VSJGXKGZSA-N |
| XLogP | 5.68 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|