C21H27N7 — CID 145120238
5-[3-[2-methyl-5-(methylamino)phenyl]prop-2-ynimidoyl]-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine (PubChem CID 145120238) has the molecular formula C21H27N7 and a molecular weight of 377.50 g/mol. Its IUPAC name is 5-[3-[2-methyl-5-(methylamino)phenyl]prop-2-ynimidoyl]-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine.
| Compound Name | 5-[3-[2-methyl-5-(methylamino)phenyl]prop-2-ynimidoyl]-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 145120238 |
| Molecular Formula | C21H27N7 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 5-[3-[2-methyl-5-(methylamino)phenyl]prop-2-ynimidoyl]-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\C#Cc1cc(NC)ccc1C)c1c(N)ncnc1NC1CCN(C)CC1 |
| InChI | InChI=1S/C21H27N7/c1-14-4-6-17(24-2)12-15(14)5-7-18(22)19-20(23)25-13-26-21(19)27-16-8-10-28(3)11-9-16/h4,6,12-13,16,22,24H,8-11H2,1-3H3,(H3,23,25,26,27)/b22-18+ |
| InChIKey | NKBIXLSLKHDNQF-RELWKKBWSA-N |
| XLogP | 2.33 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|