C25H32O3 — CID 145122006
2-[4-[4-(4-ethenylcyclohexyl)phenyl]-2-(2-methoxyethyl)phenoxy]ethanol (PubChem CID 145122006) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is 2-[4-[4-(4-ethenylcyclohexyl)phenyl]-2-(2-methoxyethyl)phenoxy]ethanol.
| Compound Name | 2-[4-[4-(4-ethenylcyclohexyl)phenyl]-2-(2-methoxyethyl)phenoxy]ethanol |
|---|---|
| PubChem CID | 145122006 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 2-[4-[4-(4-ethenylcyclohexyl)phenyl]-2-(2-methoxyethyl)phenoxy]ethanol |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(OCCO)c(CCOC)c3)cc2)CC1 |
| InChI | InChI=1S/C25H32O3/c1-3-19-4-6-20(7-5-19)21-8-10-22(11-9-21)23-12-13-25(28-17-15-26)24(18-23)14-16-27-2/h3,8-13,18-20,26H,1,4-7,14-17H2,2H3 |
| InChIKey | QMMZJJURFUSXIF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|