C20H24N2 — CID 145144139
7-butylimino-9,9-dimethylanthracen-2-amine (PubChem CID 145144139) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 7-butylimino-9,9-dimethylanthracen-2-amine.
| Compound Name | 7-butylimino-9,9-dimethylanthracen-2-amine |
|---|---|
| PubChem CID | 145144139 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 7-butylimino-9,9-dimethylanthracen-2-amine |
| SMILES | CCCC/N=C1\C=CC2=Cc3ccc(N)cc3C(C)(C)C2=C1 |
| InChI | InChI=1S/C20H24N2/c1-4-5-10-22-17-9-7-15-11-14-6-8-16(21)12-18(14)20(2,3)19(15)13-17/h6-9,11-13H,4-5,10,21H2,1-3H3/b22-17+ |
| InChIKey | HZQXYYHFHRDUDL-OQKWZONESA-N |
| XLogP | 4.68 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|