C28H33N — CID 145159728
N-[(E,1Z)-1-[3-[(1Z)-buta-1,3-dienyl]-2,2,4-trimethyl-5-methylidenecyclopent-3-en-1-ylidene]but-2-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]aniline (PubChem CID 145159728) has the molecular formula C28H33N and a molecular weight of 383.58 g/mol. Its IUPAC name is N-[(E,1Z)-1-[3-[(1Z)-buta-1,3-dienyl]-2,2,4-trimethyl-5-methylidenecyclopent-3-en-1-ylidene]but-2-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]aniline.
| Compound Name | N-[(E,1Z)-1-[3-[(1Z)-buta-1,3-dienyl]-2,2,4-trimethyl-5-methylidenecyclopent-3-en-1-ylidene]but-2-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]aniline |
|---|---|
| PubChem CID | 145159728 |
| Molecular Formula | C28H33N |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-[(E,1Z)-1-[3-[(1Z)-buta-1,3-dienyl]-2,2,4-trimethyl-5-methylidenecyclopent-3-en-1-ylidene]but-2-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]aniline |
| SMILES | C=C/C=C\C1=C(C)C(=C)/C(=C\C(=C/C)Nc2ccc(/C(C=C)=C/C)cc2)C1(C)C |
| InChI | InChI=1S/C28H33N/c1-9-13-14-26-20(5)21(6)27(28(26,7)8)19-24(12-4)29-25-17-15-23(16-18-25)22(10-2)11-3/h9-19,29H,1-2,6H2,3-5,7-8H3/b14-13-,22-11+,24-12+,27-19+ |
| InChIKey | CKVCRMHRSSIPNT-ZHARLGFGSA-N |
| XLogP | 8.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|