C15H19N5O2 — CID 145163487
1,3,7-trimethyl-8-(3-pyrrolidin-1-ylprop-1-ynyl)purine-2,6-dione (PubChem CID 145163487) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-(3-pyrrolidin-1-ylprop-1-ynyl)purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-(3-pyrrolidin-1-ylprop-1-ynyl)purine-2,6-dione |
|---|---|
| PubChem CID | 145163487 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1,3,7-trimethyl-8-(3-pyrrolidin-1-ylprop-1-ynyl)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(C#CCN3CCCC3)n2C)n(C)c1=O |
| InChI | InChI=1S/C15H19N5O2/c1-17-11(7-6-10-20-8-4-5-9-20)16-13-12(17)14(21)19(3)15(22)18(13)2/h4-5,8-10H2,1-3H3 |
| InChIKey | VDHAJPXSJFQCDC-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|