C19H36OS — CID 145179870
ethane;(3E,6E,8Z)-6-methyl-5-methylidene-4-methylsulfinyldeca-1,3,6,8-tetraene (PubChem CID 145179870) has the molecular formula C19H36OS and a molecular weight of 312.56 g/mol. Its IUPAC name is ethane;(3E,6E,8Z)-6-methyl-5-methylidene-4-methylsulfinyldeca-1,3,6,8-tetraene.
| Compound Name | ethane;(3E,6E,8Z)-6-methyl-5-methylidene-4-methylsulfinyldeca-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 145179870 |
| Molecular Formula | C19H36OS |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | ethane;(3E,6E,8Z)-6-methyl-5-methylidene-4-methylsulfinyldeca-1,3,6,8-tetraene |
| SMILES | C=C/C=C(\C(=C)/C(C)=C/C=C\C)S(C)=O.CC.CC.CC |
| InChI | InChI=1S/C13H18OS.3C2H6/c1-6-8-10-11(3)12(4)13(9-7-2)15(5)14;3*1-2/h6-10H,2,4H2,1,3,5H3;3*1-2H3/b8-6-,11-10+,13-9+;;; |
| InChIKey | TWELFHNGCSKOEG-AQVNWWNKSA-N |
| XLogP | 6.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|