C18H21N5S — CID 145233582
3-methyl-5-[2-[2-methyl-4-[methyl(propyl)amino]phenyl]hydrazinyl]thiophene-2,4-dicarbonitrile (PubChem CID 145233582) has the molecular formula C18H21N5S and a molecular weight of 339.47 g/mol. Its IUPAC name is 3-methyl-5-[2-[2-methyl-4-[methyl(propyl)amino]phenyl]hydrazinyl]thiophene-2,4-dicarbonitrile.
| Compound Name | 3-methyl-5-[2-[2-methyl-4-[methyl(propyl)amino]phenyl]hydrazinyl]thiophene-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 145233582 |
| Molecular Formula | C18H21N5S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-methyl-5-[2-[2-methyl-4-[methyl(propyl)amino]phenyl]hydrazinyl]thiophene-2,4-dicarbonitrile |
| SMILES | CCCN(C)c1ccc(NNc2sc(C#N)c(C)c2C#N)c(C)c1 |
| InChI | InChI=1S/C18H21N5S/c1-5-8-23(4)14-6-7-16(12(2)9-14)21-22-18-15(10-19)13(3)17(11-20)24-18/h6-7,9,21-22H,5,8H2,1-4H3 |
| InChIKey | SJOHKIOPUHVXHJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|