C23H33N — CID 145258753
ethane;ethene;2-[2-methyl-5-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-propan-2-yl-1H-pyrrole (PubChem CID 145258753) has the molecular formula C23H33N and a molecular weight of 323.52 g/mol. Its IUPAC name is ethane;ethene;2-[2-methyl-5-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-propan-2-yl-1H-pyrrole.
| Compound Name | ethane;ethene;2-[2-methyl-5-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-propan-2-yl-1H-pyrrole |
|---|---|
| PubChem CID | 145258753 |
| Molecular Formula | C23H33N |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | ethane;ethene;2-[2-methyl-5-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-propan-2-yl-1H-pyrrole |
| SMILES | C=C.C=C/C(=C\C)c1ccc(C)c(-c2cc(C(C)C)c[nH]2)c1.CC |
| InChI | InChI=1S/C19H23N.C2H6.C2H4/c1-6-15(7-2)16-9-8-14(5)18(10-16)19-11-17(12-20-19)13(3)4;2*1-2/h6-13,20H,1H2,2-5H3;1-2H3;1-2H2/b15-7+;; |
| InChIKey | BOPZJYHWHOUSSZ-YVCISUPJSA-N |
| XLogP | 7.53 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|