C10H8N2O3 — CID 145260888
3,10-dihydro-2H-[1,4]dioxino[2,3-h]quinoxalin-9-one (PubChem CID 145260888) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 3,10-dihydro-2H-[1,4]dioxino[2,3-h]quinoxalin-9-one.
| Compound Name | 3,10-dihydro-2H-[1,4]dioxino[2,3-h]quinoxalin-9-one |
|---|---|
| PubChem CID | 145260888 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 3,10-dihydro-2H-[1,4]dioxino[2,3-h]quinoxalin-9-one |
| SMILES | O=c1cnc2ccc3c(c2[nH]1)OCCO3 |
| InChI | InChI=1S/C10H8N2O3/c13-8-5-11-6-1-2-7-10(9(6)12-8)15-4-3-14-7/h1-2,5H,3-4H2,(H,12,13) |
| InChIKey | QERPPPQDIKGECM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |