C13H18O2S — CID 145288108
ethane;(1E,4E,5Z)-1-hydroxysulfanyl-4-prop-2-enylideneocta-1,5,7-trien-3-one (PubChem CID 145288108) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is ethane;(1E,4E,5Z)-1-hydroxysulfanyl-4-prop-2-enylideneocta-1,5,7-trien-3-one.
| Compound Name | ethane;(1E,4E,5Z)-1-hydroxysulfanyl-4-prop-2-enylideneocta-1,5,7-trien-3-one |
|---|---|
| PubChem CID | 145288108 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | ethane;(1E,4E,5Z)-1-hydroxysulfanyl-4-prop-2-enylideneocta-1,5,7-trien-3-one |
| SMILES | C=C/C=C\C(=C/C=C)C(=O)/C=C/SO.CC |
| InChI | InChI=1S/C11H12O2S.C2H6/c1-3-5-7-10(6-4-2)11(12)8-9-14-13;1-2/h3-9,13H,1-2H2;1-2H3/b7-5-,9-8+,10-6+; |
| InChIKey | UURHNOPNPUIBSL-WYJXCCOPSA-N |
| XLogP | 4.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|