C18H33NO3 — CID 145472735
tert-butyl N-[1-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxypropan-2-yl]carbamate;ethane (PubChem CID 145472735) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is tert-butyl N-[1-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxypropan-2-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[1-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxypropan-2-yl]carbamate;ethane |
|---|---|
| PubChem CID | 145472735 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | tert-butyl N-[1-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxypropan-2-yl]carbamate;ethane |
| SMILES | C=C/C(C)=C\C(=C/C)OCC(C)NC(=O)OC(C)(C)C.CC |
| InChI | InChI=1S/C16H27NO3.C2H6/c1-8-12(3)10-14(9-2)19-11-13(4)17-15(18)20-16(5,6)7;1-2/h8-10,13H,1,11H2,2-7H3,(H,17,18);1-2H3/b12-10-,14-9+; |
| InChIKey | RWZGSCKNMKVGRS-LALYYWIVSA-N |
| XLogP | 4.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|