C23H28N2O2 — CID 145484429
N-(3-ethyl-3-hydroxycyclopentyl)-9H-carbazole-3-carboxamide;prop-1-ene (PubChem CID 145484429) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-(3-ethyl-3-hydroxycyclopentyl)-9H-carbazole-3-carboxamide;prop-1-ene.
| Compound Name | N-(3-ethyl-3-hydroxycyclopentyl)-9H-carbazole-3-carboxamide;prop-1-ene |
|---|---|
| PubChem CID | 145484429 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-(3-ethyl-3-hydroxycyclopentyl)-9H-carbazole-3-carboxamide;prop-1-ene |
| SMILES | C=CC.CCC1(O)CCC(NC(=O)c2ccc3[nH]c4ccccc4c3c2)C1 |
| InChI | InChI=1S/C20H22N2O2.C3H6/c1-2-20(24)10-9-14(12-20)21-19(23)13-7-8-18-16(11-13)15-5-3-4-6-17(15)22-18;1-3-2/h3-8,11,14,22,24H,2,9-10,12H2,1H3,(H,21,23);3H,1H2,2H3 |
| InChIKey | QUCULWXZOMQQNM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|