C32H50O4 — CID 145498761
CID 145498761 (PubChem CID 145498761) has the molecular formula C32H50O4 and a molecular weight of 498.75 g/mol.
| Compound Name | CID 145498761 |
|---|---|
| PubChem CID | 145498761 |
| Molecular Formula | C32H50O4 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.37 |
| IUPAC Name | — |
| SMILES | CO[C@@H]1CCC23C(CC[C@@H]4[C@]2(CCC2(C)[C@@]4(C)CC[C@@]24OC2(CC(C)C(=O)O2)C[C@H]4C)[C@@H]3C)C1(C)C |
| InChI | InChI=1S/C32H50O4/c1-19-17-29(35-25(19)33)18-20(2)32(36-29)16-13-27(6)23-10-9-22-26(4,5)24(34-8)11-12-30(22)21(3)31(23,30)15-14-28(27,32)7/h19-24H,9-18H2,1-8H3/t19?,20-,21-,22?,23+,24-,27+,28?,29?,30?,31+,32+/m1/s1 |
| InChIKey | LOHFHYPEYQBXIY-UQNVTJCGSA-N |
| XLogP | 7.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |