About CID 145498761
CID 145498761 (PubChem CID 145498761) has the molecular formula C32H50O4
and a molecular weight of 498.75 g/mol.
Molecular Properties
| Compound Name | CID 145498761 |
| PubChem CID | 145498761 |
| Molecular Formula | C32H50O4 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.37 |
| IUPAC Name | — |
| SMILES | CO[C@@H]1CCC23C(CC[C@@H]4[C@]2(CCC2(C)[C@@]4(C)CC[C@@]24OC2(CC(C)C(=O)O2)C[C@H]4C)[C@@H]3C)C1(C)C |
| InChI | InChI=1S/C32H50O4/c1-19-17-29(35-25(19)33)18-20(2)32(36-29)16-13-27(6)23-10-9-22-26(4,5)24(34-8)11-12-30(22)21(3)31(23,30)15-14-28(27,32)7/h19-24H,9-18H2,1-8H3/t19?,20-,21-,22?,23+,24-,27+,28?,29?,30?,31+,32+/m1/s1 |
| InChIKey | LOHFHYPEYQBXIY-UQNVTJCGSA-N |
| XLogP | 7.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 145498761 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145498761?
The IUPAC name of CID 145498761 (CID 145498761) is not available.
What is the SMILES notation for CID 145498761?
The canonical SMILES for CID 145498761 is CO[C@@H]1CCC23C(CC[C@@H]4[C@]2(CCC2(C)[C@@]4(C)CC[C@@]24OC2(CC(C)C(=O)O2)C[C@H]4C)[C@@H]3C)C1(C)C.
What is the InChIKey of CID 145498761?
The InChIKey is LOHFHYPEYQBXIY-UQNVTJCGSA-N. The full InChI is InChI=1S/C32H50O4/c1-19-17-29(35-25(19)33)18-20(2)32(36-29)16-13-27(6)23-10-9-22-26(4,5)24(34-8)11-12-30(22)21(3)31(23,30)15-14-28(27,32)7/h19-24H,9-18H2,1-8H3/t19?,20-,21-,22?,23+,24-,27+,28?,29?,30?,31+,32+/m1/s1.
What are the key properties of CID 145498761?
CID 145498761 has a molecular weight of 498.75 g/mol, XLogP of 7.14, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145498761 is sourced from PubChem (CID 145498761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).