C17H27FN2O2 — CID 145498993
N-[2-[3-(6-fluoro-2-propylcyclohexa-1,3-dien-1-yl)propylamino]-2-oxoethyl]propanamide (PubChem CID 145498993) has the molecular formula C17H27FN2O2 and a molecular weight of 310.41 g/mol. Its IUPAC name is N-[2-[3-(6-fluoro-2-propylcyclohexa-1,3-dien-1-yl)propylamino]-2-oxoethyl]propanamide.
| Compound Name | N-[2-[3-(6-fluoro-2-propylcyclohexa-1,3-dien-1-yl)propylamino]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 145498993 |
| Molecular Formula | C17H27FN2O2 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | N-[2-[3-(6-fluoro-2-propylcyclohexa-1,3-dien-1-yl)propylamino]-2-oxoethyl]propanamide |
| SMILES | CCCC1=C(CCCNC(=O)CNC(=O)CC)C(F)CC=C1 |
| InChI | InChI=1S/C17H27FN2O2/c1-3-7-13-8-5-10-15(18)14(13)9-6-11-19-17(22)12-20-16(21)4-2/h5,8,15H,3-4,6-7,9-12H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | JETHHZYSFRBNTQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|