C11H5F9O2 — CID 146006052
1-(3,4-difluoro-5-methoxyphenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-one (PubChem CID 146006052) has the molecular formula C11H5F9O2 and a molecular weight of 340.14 g/mol. Its IUPAC name is 1-(3,4-difluoro-5-methoxyphenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-one.
| Compound Name | 1-(3,4-difluoro-5-methoxyphenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
|---|---|
| PubChem CID | 146006052 |
| Molecular Formula | C11H5F9O2 |
| Molecular Weight | 340.14 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 1-(3,4-difluoro-5-methoxyphenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
| SMILES | COc1cc(C(=O)C(F)(F)C(F)(F)C(F)(F)F)cc(F)c1F |
| InChI | InChI=1S/C11H5F9O2/c1-22-6-3-4(2-5(12)7(6)13)8(21)9(14,15)10(16,17)11(18,19)20/h2-3H,1H3 |
| InChIKey | HASCWVMKINZSKA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.14 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|