C17H19F2N5O3 — CID 146125697
1-(difluoromethyl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]pyrazole-3-carboxamide (PubChem CID 146125697) has the molecular formula C17H19F2N5O3 and a molecular weight of 379.37 g/mol. Its IUPAC name is 1-(difluoromethyl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-(difluoromethyl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146125697 |
| Molecular Formula | C17H19F2N5O3 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-(difluoromethyl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]pyrazole-3-carboxamide |
| SMILES | O=C(NCC1CCCO1)Nc1ccc(NC(=O)c2ccn(C(F)F)n2)cc1 |
| InChI | InChI=1S/C17H19F2N5O3/c18-16(19)24-8-7-14(23-24)15(25)21-11-3-5-12(6-4-11)22-17(26)20-10-13-2-1-9-27-13/h3-8,13,16H,1-2,9-10H2,(H,21,25)(H2,20,22,26) |
| InChIKey | SEXFRPIKSXUEJU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |