C17H20FNO — CID 146163905
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-fluoro-4-hydroxybenzonitrile (PubChem CID 146163905) has the molecular formula C17H20FNO and a molecular weight of 273.35 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-fluoro-4-hydroxybenzonitrile.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-fluoro-4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 146163905 |
| Molecular Formula | C17H20FNO |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-fluoro-4-hydroxybenzonitrile |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc(C#N)cc(F)c1O |
| InChI | InChI=1S/C17H20FNO/c1-12(2)5-4-6-13(3)7-8-15-9-14(11-19)10-16(18)17(15)20/h5,7,9-10,20H,4,6,8H2,1-3H3/b13-7+ |
| InChIKey | WUHBBYRUZMSRHK-NTUHNPAUSA-N |
| XLogP | 4.64 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|