C44H44N4O4S — CID 146164737
bis[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] thiophene-2,5-dicarboxylate (PubChem CID 146164737) has the molecular formula C44H44N4O4S and a molecular weight of 724.93 g/mol. Its IUPAC name is bis[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] thiophene-2,5-dicarboxylate.
| Compound Name | bis[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] thiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 146164737 |
| Molecular Formula | C44H44N4O4S |
| Molecular Weight | 724.93 g/mol |
| Exact Mass | 724.31 |
| IUPAC Name | bis[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] thiophene-2,5-dicarboxylate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](OC(=O)c1ccc(C(=O)O[C@@H](c2ccnc3ccccc23)[C@@H]2C[C@@H]3CCN2C[C@@H]3C=C)s1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C44H44N4O4S/c1-3-27-25-47-21-17-29(27)23-37(47)41(33-15-19-45-35-11-7-5-9-31(33)35)51-43(49)39-13-14-40(53-39)44(50)52-42(34-16-20-46-36-12-8-6-10-32(34)36)38-24-30-18-22-48(38)26-28(30)4-2/h3-16,19-20,27-30,37-38,41-42H,1-2,17-18,21-26H2/t27-,28-,29-,30-,37-,38-,41-,42-/m0/s1 |
| InChIKey | RNBOQMWMBUOZSI-XMHUXAHFSA-N |
| XLogP | 8.43 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.93 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|