C12H10F13I — CID 146167904
(E)-7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododec-5-ene (PubChem CID 146167904) has the molecular formula C12H10F13I and a molecular weight of 528.09 g/mol. Its IUPAC name is (E)-7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododec-5-ene.
| Compound Name | (E)-7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododec-5-ene |
|---|---|
| PubChem CID | 146167904 |
| Molecular Formula | C12H10F13I |
| Molecular Weight | 528.09 g/mol |
| Exact Mass | 527.96 |
| IUPAC Name | (E)-7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-5-iodododec-5-ene |
| SMILES | CCCC/C(I)=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H10F13I/c1-2-3-4-6(26)5-7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h5H,2-4H2,1H3/b6-5+ |
| InChIKey | NOGMJMXYNGMAOX-AATRIKPKSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.09 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|