C33H45NO11S — CID 146262632
propan-2-yloxycarbonyloxymethyl 4-[5-[(4-acetyloxyphenyl)methoxyamino]-5-oxo-2-[2-oxo-2-[2-(trimethyl-λ4-sulfanyl)ethoxy]ethyl]pentyl]benzoate (PubChem CID 146262632) has the molecular formula C33H45NO11S and a molecular weight of 663.79 g/mol. Its IUPAC name is propan-2-yloxycarbonyloxymethyl 4-[5-[(4-acetyloxyphenyl)methoxyamino]-5-oxo-2-[2-oxo-2-[2-(trimethyl-λ4-sulfanyl)ethoxy]ethyl]pentyl]benzoate.
| Compound Name | propan-2-yloxycarbonyloxymethyl 4-[5-[(4-acetyloxyphenyl)methoxyamino]-5-oxo-2-[2-oxo-2-[2-(trimethyl-λ4-sulfanyl)ethoxy]ethyl]pentyl]benzoate |
|---|---|
| PubChem CID | 146262632 |
| Molecular Formula | C33H45NO11S |
| Molecular Weight | 663.79 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | propan-2-yloxycarbonyloxymethyl 4-[5-[(4-acetyloxyphenyl)methoxyamino]-5-oxo-2-[2-oxo-2-[2-(trimethyl-λ4-sulfanyl)ethoxy]ethyl]pentyl]benzoate |
| SMILES | CC(=O)Oc1ccc(CONC(=O)CCC(CC(=O)OCCS(C)(C)C)Cc2ccc(C(=O)OCOC(=O)OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H45NO11S/c1-23(2)44-33(39)42-22-41-32(38)28-12-7-25(8-13-28)19-27(20-31(37)40-17-18-46(4,5)6)11-16-30(36)34-43-21-26-9-14-29(15-10-26)45-24(3)35/h7-10,12-15,23,27H,11,16-22H2,1-6H3,(H,34,36) |
| InChIKey | SKGNSBNJKQKHSA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.79 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|