C24H29F6N3O5 — CID 146263460
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-(1-butoxy-2-methyl-1-oxopropan-2-yl)oxy-5-cyanophenyl]methyl]piperazine-1-carboxylate (PubChem CID 146263460) has the molecular formula C24H29F6N3O5 and a molecular weight of 553.50 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-(1-butoxy-2-methyl-1-oxopropan-2-yl)oxy-5-cyanophenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-(1-butoxy-2-methyl-1-oxopropan-2-yl)oxy-5-cyanophenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 146263460 |
| Molecular Formula | C24H29F6N3O5 |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-(1-butoxy-2-methyl-1-oxopropan-2-yl)oxy-5-cyanophenyl]methyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)C(C)(C)Oc1cc(C#N)cc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C24H29F6N3O5/c1-4-5-10-36-20(34)22(2,3)38-18-12-16(14-31)11-17(13-18)15-32-6-8-33(9-7-32)21(35)37-19(23(25,26)27)24(28,29)30/h11-13,19H,4-10,15H2,1-3H3 |
| InChIKey | VHXHVKQVUHOTSD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 92.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|