C23H31ClN4O2 — CID 146413366
methyl 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[5-(chloromethyl)-6-methyl-3-pyridinyl]-2,2-dimethylpropanoate (PubChem CID 146413366) has the molecular formula C23H31ClN4O2 and a molecular weight of 430.98 g/mol. Its IUPAC name is methyl 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[5-(chloromethyl)-6-methyl-3-pyridinyl]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[5-(chloromethyl)-6-methyl-3-pyridinyl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146413366 |
| Molecular Formula | C23H31ClN4O2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | methyl 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[5-(chloromethyl)-6-methyl-3-pyridinyl]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)C(c1cnc(C)c(CCl)c1)c1ccc(N(N)C2CC2)c(N)c1C |
| InChI | InChI=1S/C23H31ClN4O2/c1-13-18(8-9-19(21(13)25)28(26)17-6-7-17)20(23(3,4)22(29)30-5)16-10-15(11-24)14(2)27-12-16/h8-10,12,17,20H,6-7,11,25-26H2,1-5H3 |
| InChIKey | QNIBUPLCJOSXKM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|