C18H21F2N3O2 — CID 146624230
(6S,7S)-6-fluoro-7-(3-fluorophenyl)-3-(oxan-4-yl)-1,2,5,6,7,8-hexahydropyrido[2,3-d]pyrimidin-4-one (PubChem CID 146624230) has the molecular formula C18H21F2N3O2 and a molecular weight of 349.38 g/mol. Its IUPAC name is (6S,7S)-6-fluoro-7-(3-fluorophenyl)-3-(oxan-4-yl)-1,2,5,6,7,8-hexahydropyrido[2,3-d]pyrimidin-4-one.
| Compound Name | (6S,7S)-6-fluoro-7-(3-fluorophenyl)-3-(oxan-4-yl)-1,2,5,6,7,8-hexahydropyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 146624230 |
| Molecular Formula | C18H21F2N3O2 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (6S,7S)-6-fluoro-7-(3-fluorophenyl)-3-(oxan-4-yl)-1,2,5,6,7,8-hexahydropyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=C1C2=C(NCN1C1CCOCC1)N[C@@H](c1cccc(F)c1)[C@@H](F)C2 |
| InChI | InChI=1S/C18H21F2N3O2/c19-12-3-1-2-11(8-12)16-15(20)9-14-17(22-16)21-10-23(18(14)24)13-4-6-25-7-5-13/h1-3,8,13,15-16,21-22H,4-7,9-10H2/t15-,16-/m0/s1 |
| InChIKey | YYESZSINCCXXKD-HOTGVXAUSA-N |
| XLogP | 1.98 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |