C16H21N3O5 — CID 146633824
ethyl (4E)-4-hydroxyimino-6-methoxyspiro[3H-pyrano[3,2-b]pyridine-2,4'-piperidine]-1'-carboxylate (PubChem CID 146633824) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is ethyl (4E)-4-hydroxyimino-6-methoxyspiro[3H-pyrano[3,2-b]pyridine-2,4'-piperidine]-1'-carboxylate.
| Compound Name | ethyl (4E)-4-hydroxyimino-6-methoxyspiro[3H-pyrano[3,2-b]pyridine-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 146633824 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | ethyl (4E)-4-hydroxyimino-6-methoxyspiro[3H-pyrano[3,2-b]pyridine-2,4'-piperidine]-1'-carboxylate |
| SMILES | CCOC(=O)N1CCC2(CC1)C/C(=N\O)c1nc(OC)ccc1O2 |
| InChI | InChI=1S/C16H21N3O5/c1-3-23-15(20)19-8-6-16(7-9-19)10-11(18-21)14-12(24-16)4-5-13(17-14)22-2/h4-5,21H,3,6-10H2,1-2H3/b18-11+ |
| InChIKey | LKBWNIDTTKULQO-WOJGMQOQSA-N |
| XLogP | 2.04 |
| TPSA | 93.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|