C19H30FN7O6P+ — CID 146912291
propan-2-yl 2-[[6-[2-amino-6-(dimethylamino)-7H-purin-9-ium-9-yl]-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate (PubChem CID 146912291) has the molecular formula C19H30FN7O6P+ and a molecular weight of 502.46 g/mol. Its IUPAC name is propan-2-yl 2-[[6-[2-amino-6-(dimethylamino)-7H-purin-9-ium-9-yl]-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[6-[2-amino-6-(dimethylamino)-7H-purin-9-ium-9-yl]-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 146912291 |
| Molecular Formula | C19H30FN7O6P+ |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | propan-2-yl 2-[[6-[2-amino-6-(dimethylamino)-7H-purin-9-ium-9-yl]-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP1(=O)OCC2OC([n+]3c[nH]c4c(N(C)C)nc(N)nc43)C(C)(F)C2O1 |
| InChI | InChI=1S/C19H29FN7O6P/c1-9(2)31-16(28)10(3)25-34(29)30-7-11-13(33-34)19(4,20)17(32-11)27-8-22-12-14(26(5)6)23-18(21)24-15(12)27/h8-11,13,17H,7H2,1-6H3,(H3,21,23,24,25,29)/p+1 |
| InChIKey | GNBOBNWTWCARIP-UHFFFAOYSA-O |
| XLogP | 0.97 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|