C13H18BNO6 — CID 146936545
5-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 146936545) has the molecular formula C13H18BNO6 and a molecular weight of 295.10 g/mol. Its IUPAC name is 5-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 5-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 146936545 |
| Molecular Formula | C13H18BNO6 |
| Molecular Weight | 295.10 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 5-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CC1(C)OB(C2CC=C(C(=O)O)C=C2[N+](=O)[O-])OC1(C)C |
| InChI | InChI=1S/C13H18BNO6/c1-12(2)13(3,4)21-14(20-12)9-6-5-8(11(16)17)7-10(9)15(18)19/h5,7,9H,6H2,1-4H3,(H,16,17) |
| InChIKey | AGAOOZGCPFVEDV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.10 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|