C11H17NOS — CID 14709373
spiro[3,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]oxazine-4,1'-cyclopentane]-2-thione (PubChem CID 14709373) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is spiro[3,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]oxazine-4,1'-cyclopentane]-2-thione.
| Compound Name | spiro[3,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]oxazine-4,1'-cyclopentane]-2-thione |
|---|---|
| PubChem CID | 14709373 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | spiro[3,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]oxazine-4,1'-cyclopentane]-2-thione |
| SMILES | S=C1NC2(CCCC2)C2CCCC2O1 |
| InChI | InChI=1S/C11H17NOS/c14-10-12-11(6-1-2-7-11)8-4-3-5-9(8)13-10/h8-9H,1-7H2,(H,12,14) |
| InChIKey | MMNBZBLNQXOIRO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|