C13H21NOS — CID 821408
(4aR,8aR)-spiro[4a,5,6,7,8,8a-hexahydro-3H-benzo[e][1,3]oxazine-4,1'-cyclohexane]-2-thione (PubChem CID 821408) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is (4aR,8aR)-spiro[4a,5,6,7,8,8a-hexahydro-3H-benzo[e][1,3]oxazine-4,1'-cyclohexane]-2-thione.
| Compound Name | (4aR,8aR)-spiro[4a,5,6,7,8,8a-hexahydro-3H-benzo[e][1,3]oxazine-4,1'-cyclohexane]-2-thione |
|---|---|
| PubChem CID | 821408 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (4aR,8aR)-spiro[4a,5,6,7,8,8a-hexahydro-3H-benzo[e][1,3]oxazine-4,1'-cyclohexane]-2-thione |
| SMILES | S=C1NC2(CCCCC2)[C@H]2CCCC[C@H]2O1 |
| InChI | InChI=1S/C13H21NOS/c16-12-14-13(8-4-1-5-9-13)10-6-2-3-7-11(10)15-12/h10-11H,1-9H2,(H,14,16)/t10-,11+/m0/s1 |
| InChIKey | PGFAZFZATRJKKG-WDEREUQCSA-N |
| XLogP | 3.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|