C16H27N3OS — CID 40531407
(4aR,8aR)-8a-hydroxy-1-(propan-2-ylideneamino)spiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione (PubChem CID 40531407) has the molecular formula C16H27N3OS and a molecular weight of 309.48 g/mol. Its IUPAC name is (4aR,8aR)-8a-hydroxy-1-(propan-2-ylideneamino)spiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione.
| Compound Name | (4aR,8aR)-8a-hydroxy-1-(propan-2-ylideneamino)spiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione |
|---|---|
| PubChem CID | 40531407 |
| Molecular Formula | C16H27N3OS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (4aR,8aR)-8a-hydroxy-1-(propan-2-ylideneamino)spiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione |
| SMILES | CC(C)=NN1C(=S)NC2(CCCCC2)[C@H]2CCCC[C@@]21O |
| InChI | InChI=1S/C16H27N3OS/c1-12(2)18-19-14(21)17-15(9-5-3-6-10-15)13-8-4-7-11-16(13,19)20/h13,20H,3-11H2,1-2H3,(H,17,21)/t13-,16-/m1/s1 |
| InChIKey | WOVKALGXZDOIAT-CZUORRHYSA-N |
| XLogP | 3.15 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|