C11H18O3 — CID 14739221
(2R,5Z,6R)-2-tert-butyl-5-ethylidene-6-methyl-1,3-dioxan-4-one (PubChem CID 14739221) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (2R,5Z,6R)-2-tert-butyl-5-ethylidene-6-methyl-1,3-dioxan-4-one.
| Compound Name | (2R,5Z,6R)-2-tert-butyl-5-ethylidene-6-methyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 14739221 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (2R,5Z,6R)-2-tert-butyl-5-ethylidene-6-methyl-1,3-dioxan-4-one |
| SMILES | C/C=C1\C(=O)O[C@H](C(C)(C)C)O[C@@H]1C |
| InChI | InChI=1S/C11H18O3/c1-6-8-7(2)13-10(11(3,4)5)14-9(8)12/h6-7,10H,1-5H3/b8-6-/t7-,10-/m1/s1 |
| InChIKey | APDRCOWRJUJNIJ-SNPOQERRSA-N |
| XLogP | 2.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|