C14H24O3 — CID 14739224
(2R,5E,6R)-2-tert-butyl-6-methyl-5-pentylidene-1,3-dioxan-4-one (PubChem CID 14739224) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (2R,5E,6R)-2-tert-butyl-6-methyl-5-pentylidene-1,3-dioxan-4-one.
| Compound Name | (2R,5E,6R)-2-tert-butyl-6-methyl-5-pentylidene-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 14739224 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (2R,5E,6R)-2-tert-butyl-6-methyl-5-pentylidene-1,3-dioxan-4-one |
| SMILES | CCCC/C=C1/C(=O)O[C@H](C(C)(C)C)O[C@@H]1C |
| InChI | InChI=1S/C14H24O3/c1-6-7-8-9-11-10(2)16-13(14(3,4)5)17-12(11)15/h9-10,13H,6-8H2,1-5H3/b11-9+/t10-,13-/m1/s1 |
| InChIKey | DZDOJXNACAULFP-RLMBRUFRSA-N |
| XLogP | 3.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|