C15H11ClN2OS — CID 1475209
2-[(3-chloroanilino)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 1475209) has the molecular formula C15H11ClN2OS and a molecular weight of 302.79 g/mol. Its IUPAC name is 2-[(3-chloroanilino)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-[(3-chloroanilino)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 1475209 |
| Molecular Formula | C15H11ClN2OS |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-[(3-chloroanilino)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2SC1=CNc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H11ClN2OS/c16-10-4-3-5-11(8-10)17-9-14-15(19)18-12-6-1-2-7-13(12)20-14/h1-9,17H,(H,18,19) |
| InChIKey | JUATYUIPUIQTHK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|