C17H15N5O2S2 — CID 1479362
(7R,7aS)-7-methyl-7-(4-nitrophenyl)-3-phenyl-6,7a-dihydro-1H-imidazo[1,5-b][1,2,4]triazole-2,5-dithione (PubChem CID 1479362) has the molecular formula C17H15N5O2S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is (7R,7aS)-7-methyl-7-(4-nitrophenyl)-3-phenyl-6,7a-dihydro-1H-imidazo[1,5-b][1,2,4]triazole-2,5-dithione.
| Compound Name | (7R,7aS)-7-methyl-7-(4-nitrophenyl)-3-phenyl-6,7a-dihydro-1H-imidazo[1,5-b][1,2,4]triazole-2,5-dithione |
|---|---|
| PubChem CID | 1479362 |
| Molecular Formula | C17H15N5O2S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (7R,7aS)-7-methyl-7-(4-nitrophenyl)-3-phenyl-6,7a-dihydro-1H-imidazo[1,5-b][1,2,4]triazole-2,5-dithione |
| SMILES | C[C@]1(c2ccc([N+](=O)[O-])cc2)NC(=S)N2[C@@H]1NC(=S)N2c1ccccc1 |
| InChI | InChI=1S/C17H15N5O2S2/c1-17(11-7-9-13(10-8-11)22(23)24)14-18-15(25)20(21(14)16(26)19-17)12-5-3-2-4-6-12/h2-10,14H,1H3,(H,18,25)(H,19,26)/t14-,17+/m0/s1 |
| InChIKey | OTEHUHFNVVBGEZ-WMLDXEAASA-N |
| XLogP | 2.64 |
| TPSA | 73.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|