C20H36FN5O — CID 148681012
4-fluoro-7-methyl-N-[4-(4-methylpiperazin-1-yl)piperidin-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 148681012) has the molecular formula C20H36FN5O and a molecular weight of 381.54 g/mol. Its IUPAC name is 4-fluoro-7-methyl-N-[4-(4-methylpiperazin-1-yl)piperidin-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-7-methyl-N-[4-(4-methylpiperazin-1-yl)piperidin-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 148681012 |
| Molecular Formula | C20H36FN5O |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | 4-fluoro-7-methyl-N-[4-(4-methylpiperazin-1-yl)piperidin-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)NC3CC(N4CCN(C)CC4)CCN3)NC12 |
| InChI | InChI=1S/C20H36FN5O/c1-13-3-4-16(21)15-12-17(23-19(13)15)20(27)24-18-11-14(5-6-22-18)26-9-7-25(2)8-10-26/h13-19,22-23H,3-12H2,1-2H3,(H,24,27) |
| InChIKey | SZILLMLTBHVEHR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |