C43H38FNO6 — CID 14883325
ethyl 6-fluoro-1-[4-(methoxymethoxy)-2-methylphenyl]-4-oxo-7-(3-trityloxyprop-1-en-2-yl)quinoline-3-carboxylate (PubChem CID 14883325) has the molecular formula C43H38FNO6 and a molecular weight of 683.78 g/mol. Its IUPAC name is ethyl 6-fluoro-1-[4-(methoxymethoxy)-2-methylphenyl]-4-oxo-7-(3-trityloxyprop-1-en-2-yl)quinoline-3-carboxylate.
| Compound Name | ethyl 6-fluoro-1-[4-(methoxymethoxy)-2-methylphenyl]-4-oxo-7-(3-trityloxyprop-1-en-2-yl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 14883325 |
| Molecular Formula | C43H38FNO6 |
| Molecular Weight | 683.78 g/mol |
| Exact Mass | 683.27 |
| IUPAC Name | ethyl 6-fluoro-1-[4-(methoxymethoxy)-2-methylphenyl]-4-oxo-7-(3-trityloxyprop-1-en-2-yl)quinoline-3-carboxylate |
| SMILES | C=C(COC(c1ccccc1)(c1ccccc1)c1ccccc1)c1cc2c(cc1F)c(=O)c(C(=O)OCC)cn2-c1ccc(OCOC)cc1C |
| InChI | InChI=1S/C43H38FNO6/c1-5-49-42(47)37-26-45(39-22-21-34(23-29(39)2)50-28-48-4)40-25-35(38(44)24-36(40)41(37)46)30(3)27-51-43(31-15-9-6-10-16-31,32-17-11-7-12-18-32)33-19-13-8-14-20-33/h6-26H,3,5,27-28H2,1-2,4H3 |
| InChIKey | DFINIEPPFGZISM-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.78 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|