C9H9F5O3 — CID 150173929
[3-(2,2,3,3,3-pentafluoropropyl)oxiran-2-yl]methyl prop-2-enoate (PubChem CID 150173929) has the molecular formula C9H9F5O3 and a molecular weight of 260.16 g/mol. Its IUPAC name is [3-(2,2,3,3,3-pentafluoropropyl)oxiran-2-yl]methyl prop-2-enoate.
| Compound Name | [3-(2,2,3,3,3-pentafluoropropyl)oxiran-2-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 150173929 |
| Molecular Formula | C9H9F5O3 |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | [3-(2,2,3,3,3-pentafluoropropyl)oxiran-2-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1OC1CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F5O3/c1-2-7(15)16-4-6-5(17-6)3-8(10,11)9(12,13)14/h2,5-6H,1,3-4H2 |
| InChIKey | FJZWUXHUVIYGAM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|